C24H33NO6S — CID 10276555
N-(2-hydroxyethyl)-2-[[4-[3-(1-hydroxyhexyl)-4-methoxyphenyl]phenyl]methylsulfonyl]acetamide (PubChem CID 10276555) has the molecular formula C24H33NO6S and a molecular weight of 463.60 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[[4-[3-(1-hydroxyhexyl)-4-methoxyphenyl]phenyl]methylsulfonyl]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[[4-[3-(1-hydroxyhexyl)-4-methoxyphenyl]phenyl]methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 10276555 |
| Molecular Formula | C24H33NO6S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[[4-[3-(1-hydroxyhexyl)-4-methoxyphenyl]phenyl]methylsulfonyl]acetamide |
| SMILES | CCCCCC(O)c1cc(-c2ccc(CS(=O)(=O)CC(=O)NCCO)cc2)ccc1OC |
| InChI | InChI=1S/C24H33NO6S/c1-3-4-5-6-22(27)21-15-20(11-12-23(21)31-2)19-9-7-18(8-10-19)16-32(29,30)17-24(28)25-13-14-26/h7-12,15,22,26-27H,3-6,13-14,16-17H2,1-2H3,(H,25,28) |
| InChIKey | BUSCXWCTGCVQKU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|