About (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine
(3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine (PubChem CID 142167682) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine.
Molecular Properties
| Compound Name | (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine |
| PubChem CID | 142167682 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine |
| SMILES | C=C/C(=C(\CCC)NC(=C)OC)C1CCNCC1 |
| InChI | InChI=1S/C15H26N2O/c1-5-7-15(17-12(3)18-4)14(6-2)13-8-10-16-11-9-13/h6,13,16-17H,2-3,5,7-11H2,1,4H3/b15-14- |
| InChIKey | KDYZEHCNGXCECF-PFONDFGASA-N |
| XLogP | 2.93 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine?
The IUPAC name of (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine (CID 142167682) is (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine.
What is the SMILES notation for (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine?
The canonical SMILES for (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine is C=C/C(=C(\CCC)NC(=C)OC)C1CCNCC1.
What is the InChIKey of (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine?
The InChIKey is KDYZEHCNGXCECF-PFONDFGASA-N. The full InChI is InChI=1S/C15H26N2O/c1-5-7-15(17-12(3)18-4)14(6-2)13-8-10-16-11-9-13/h6,13,16-17H,2-3,5,7-11H2,1,4H3/b15-14-.
What are the key properties of (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine?
(3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine has a molecular weight of 250.39 g/mol, XLogP of 2.93, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-(1-methoxyethenyl)-3-piperidin-4-ylhepta-1,3-dien-4-amine is sourced from PubChem (CID 142167682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).