C37H59NO4 — CID 142168449
ethyl 2-[[(2S,4aS,6aR,6aS,6bR,10S,14bR)-10-ethyl-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carbonyl]amino]propanoate (PubChem CID 142168449) has the molecular formula C37H59NO4 and a molecular weight of 581.88 g/mol. Its IUPAC name is ethyl 2-[[(2S,4aS,6aR,6aS,6bR,10S,14bR)-10-ethyl-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carbonyl]amino]propanoate.
| Compound Name | ethyl 2-[[(2S,4aS,6aR,6aS,6bR,10S,14bR)-10-ethyl-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 142168449 |
| Molecular Formula | C37H59NO4 |
| Molecular Weight | 581.88 g/mol |
| Exact Mass | 581.44 |
| IUPAC Name | ethyl 2-[[(2S,4aS,6aR,6aS,6bR,10S,14bR)-10-ethyl-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)[C@@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4C5(C)CC[C@H](CC)C(C)(C)C5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C37H59NO4/c1-11-24-13-15-35(8)28(32(24,4)5)14-16-37(10)29(35)27(39)21-25-26-22-34(7,31(41)38-23(3)30(40)42-12-2)18-17-33(26,6)19-20-36(25,37)9/h21,23-24,26,28-29H,11-20,22H2,1-10H3,(H,38,41)/t23?,24-,26-,28?,29+,33+,34-,35?,36+,37+/m0/s1 |
| InChIKey | YDLRUBHSQIMIHA-QSNJWFJDSA-N |
| XLogP | 8.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.88 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |