C28H32N8O4 — CID 142169746
4-[7-[3-[amino-[(Z)-2-aminoethenyl]amino]propoxy]-3-formyl-6-methoxyquinolin-4-yl]-N-(4-cyanophenyl)piperazine-1-carboxamide (PubChem CID 142169746) has the molecular formula C28H32N8O4 and a molecular weight of 544.62 g/mol. Its IUPAC name is 4-[7-[3-[amino-[(Z)-2-aminoethenyl]amino]propoxy]-3-formyl-6-methoxyquinolin-4-yl]-N-(4-cyanophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[7-[3-[amino-[(Z)-2-aminoethenyl]amino]propoxy]-3-formyl-6-methoxyquinolin-4-yl]-N-(4-cyanophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 142169746 |
| Molecular Formula | C28H32N8O4 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 4-[7-[3-[amino-[(Z)-2-aminoethenyl]amino]propoxy]-3-formyl-6-methoxyquinolin-4-yl]-N-(4-cyanophenyl)piperazine-1-carboxamide |
| SMILES | COc1cc2c(N3CCN(C(=O)Nc4ccc(C#N)cc4)CC3)c(C=O)cnc2cc1OCCCN(N)/C=C\N |
| InChI | InChI=1S/C28H32N8O4/c1-39-25-15-23-24(16-26(25)40-14-2-8-36(31)9-7-29)32-18-21(19-37)27(23)34-10-12-35(13-11-34)28(38)33-22-5-3-20(17-30)4-6-22/h3-7,9,15-16,18-19H,2,8,10-14,29,31H2,1H3,(H,33,38)/b9-7- |
| InChIKey | IVHUDVOVIMUHFV-CLFYSBASSA-N |
| XLogP | 2.66 |
| TPSA | 163.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|