C30H36N8O5 — CID 142169747
ethyl 7-[3-[amino-[(Z)-2-aminoethenyl]amino]propoxy]-4-[4-[(4-cyanophenyl)carbamoyl]piperazin-1-yl]-6-methoxyquinoline-3-carboxylate (PubChem CID 142169747) has the molecular formula C30H36N8O5 and a molecular weight of 588.67 g/mol. Its IUPAC name is ethyl 7-[3-[amino-[(Z)-2-aminoethenyl]amino]propoxy]-4-[4-[(4-cyanophenyl)carbamoyl]piperazin-1-yl]-6-methoxyquinoline-3-carboxylate.
| Compound Name | ethyl 7-[3-[amino-[(Z)-2-aminoethenyl]amino]propoxy]-4-[4-[(4-cyanophenyl)carbamoyl]piperazin-1-yl]-6-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 142169747 |
| Molecular Formula | C30H36N8O5 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | ethyl 7-[3-[amino-[(Z)-2-aminoethenyl]amino]propoxy]-4-[4-[(4-cyanophenyl)carbamoyl]piperazin-1-yl]-6-methoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OCCCN(N)/C=C\N)c(OC)cc2c1N1CCN(C(=O)Nc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C30H36N8O5/c1-3-42-29(39)24-20-34-25-18-27(43-16-4-10-38(33)11-9-31)26(41-2)17-23(25)28(24)36-12-14-37(15-13-36)30(40)35-22-7-5-21(19-32)6-8-22/h5-9,11,17-18,20H,3-4,10,12-16,31,33H2,1-2H3,(H,35,40)/b11-9- |
| InChIKey | ZZQXODBLXYQASO-LUAWRHEFSA-N |
| XLogP | 3.02 |
| TPSA | 172.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|