C30H36N6O4 — CID 10230748
N-(4-cyanophenyl)-4-[3-(hydroxymethyl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]piperazine-1-carboxamide (PubChem CID 10230748) has the molecular formula C30H36N6O4 and a molecular weight of 544.66 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-[3-(hydroxymethyl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]piperazine-1-carboxamide.
| Compound Name | N-(4-cyanophenyl)-4-[3-(hydroxymethyl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 10230748 |
| Molecular Formula | C30H36N6O4 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | N-(4-cyanophenyl)-4-[3-(hydroxymethyl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]piperazine-1-carboxamide |
| SMILES | COc1cc2c(N3CCN(C(=O)Nc4ccc(C#N)cc4)CC3)c(CO)cnc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C30H36N6O4/c1-39-27-17-25-26(18-28(27)40-16-4-11-34-9-2-3-10-34)32-20-23(21-37)29(25)35-12-14-36(15-13-35)30(38)33-24-7-5-22(19-31)6-8-24/h5-8,17-18,20,37H,2-4,9-16,21H2,1H3,(H,33,38) |
| InChIKey | NCGOFXSUOKOAJU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|