C29H32FN5O4 — CID 91206858
(4-cyanophenyl) 4-[3-fluoro-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]piperazine-1-carboxylate (PubChem CID 91206858) has the molecular formula C29H32FN5O4 and a molecular weight of 533.60 g/mol. Its IUPAC name is (4-cyanophenyl) 4-[3-fluoro-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]piperazine-1-carboxylate.
| Compound Name | (4-cyanophenyl) 4-[3-fluoro-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91206858 |
| Molecular Formula | C29H32FN5O4 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (4-cyanophenyl) 4-[3-fluoro-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]piperazine-1-carboxylate |
| SMILES | COc1cc2c(N3CCN(C(=O)Oc4ccc(C#N)cc4)CC3)c(F)cnc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C29H32FN5O4/c1-37-26-17-23-25(18-27(26)38-16-4-11-33-9-2-3-10-33)32-20-24(30)28(23)34-12-14-35(15-13-34)29(36)39-22-7-5-21(19-31)6-8-22/h5-8,17-18,20H,2-4,9-16H2,1H3 |
| InChIKey | HAEIRXDCSWCFDO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 91.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|