C31H37FN4O3 — CID 142171138
1-[2-[1-[(4-fluorocyclohepta-2,4,6-trien-1-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3-(5,6,7,8-tetrahydroquinolin-4-yl)urea (PubChem CID 142171138) has the molecular formula C31H37FN4O3 and a molecular weight of 532.66 g/mol. Its IUPAC name is 1-[2-[1-[(4-fluorocyclohepta-2,4,6-trien-1-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3-(5,6,7,8-tetrahydroquinolin-4-yl)urea.
| Compound Name | 1-[2-[1-[(4-fluorocyclohepta-2,4,6-trien-1-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3-(5,6,7,8-tetrahydroquinolin-4-yl)urea |
|---|---|
| PubChem CID | 142171138 |
| Molecular Formula | C31H37FN4O3 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 1-[2-[1-[(4-fluorocyclohepta-2,4,6-trien-1-yl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-3-(5,6,7,8-tetrahydroquinolin-4-yl)urea |
| SMILES | COc1cc2c(cc1OC)C(CC1C=CC=C(F)C=C1)N(CCNC(=O)Nc1ccnc3c1CCCC3)CC2 |
| InChI | InChI=1S/C31H37FN4O3/c1-38-29-19-22-13-16-36(17-15-34-31(37)35-27-12-14-33-26-9-4-3-8-24(26)27)28(25(22)20-30(29)39-2)18-21-6-5-7-23(32)11-10-21/h5-7,10-12,14,19-21,28H,3-4,8-9,13,15-18H2,1-2H3,(H2,33,34,35,37) |
| InChIKey | COESNWODYGXKDC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |