C16H23N — CID 142171223
(4E,5E)-4-ethylidene-N,N,6-trimethyl-7-methylidenedeca-5,9-dien-2-yn-1-amine (PubChem CID 142171223) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (4E,5E)-4-ethylidene-N,N,6-trimethyl-7-methylidenedeca-5,9-dien-2-yn-1-amine.
| Compound Name | (4E,5E)-4-ethylidene-N,N,6-trimethyl-7-methylidenedeca-5,9-dien-2-yn-1-amine |
|---|---|
| PubChem CID | 142171223 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (4E,5E)-4-ethylidene-N,N,6-trimethyl-7-methylidenedeca-5,9-dien-2-yn-1-amine |
| SMILES | C=CCC(=C)/C(C)=C/C(C#CCN(C)C)=C\C |
| InChI | InChI=1S/C16H23N/c1-7-10-14(3)15(4)13-16(8-2)11-9-12-17(5)6/h7-8,13H,1,3,10,12H2,2,4-6H3/b15-13+,16-8- |
| InChIKey | ZKKXROQLVOSVKN-JOHDTNNHSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|