About 4-(dimethylamino)but-2-ynoic acid lithium hydride
4-(dimethylamino)but-2-ynoic acid lithium hydride (PubChem CID 171035063) has the molecular formula C6H9LiNO2
and a molecular weight of 134.08 g/mol.
Molecular Properties
| Compound Name | 4-(dimethylamino)but-2-ynoic acid lithium hydride |
| PubChem CID | 171035063 |
| Molecular Formula | C6H9LiNO2 |
| Molecular Weight | 134.08 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | — |
| SMILES | CN(C)CC#CC(=O)O.[Li] |
| InChI | InChI=1S/C6H9NO2.Li/c1-7(2)5-3-4-6(8)9;/h5H2,1-2H3,(H,8,9); |
| InChIKey | UDCUFAWUVZPKPJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.08 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)but-2-ynoic acid lithium hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)but-2-ynoic acid lithium hydride?
The IUPAC name of 4-(dimethylamino)but-2-ynoic acid lithium hydride (CID 171035063) is not available.
What is the SMILES notation for 4-(dimethylamino)but-2-ynoic acid lithium hydride?
The canonical SMILES for 4-(dimethylamino)but-2-ynoic acid lithium hydride is CN(C)CC#CC(=O)O.[Li].
What is the InChIKey of 4-(dimethylamino)but-2-ynoic acid lithium hydride?
The InChIKey is UDCUFAWUVZPKPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.Li/c1-7(2)5-3-4-6(8)9;/h5H2,1-2H3,(H,8,9);.
What are the key properties of 4-(dimethylamino)but-2-ynoic acid lithium hydride?
4-(dimethylamino)but-2-ynoic acid lithium hydride has a molecular weight of 134.08 g/mol, XLogP of -0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)but-2-ynoic acid lithium hydride is sourced from PubChem (CID 171035063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).