About 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione
2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione (PubChem CID 142171356) has the molecular formula C22H19N5O7
and a molecular weight of 465.42 g/mol. Its IUPAC name is 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione |
| PubChem CID | 142171356 |
| Molecular Formula | C22H19N5O7 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1O.O=Cc1ccccc1C(=O)NCCCn1ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N4O4.C8H5NO3/c19-10-11-4-1-2-5-12(11)13(20)15-6-3-8-17-9-7-16-14(17)18(21)22;10-7-5-3-1-2-4-6(5)8(11)9(7)12/h1-2,4-5,7,9-10H,3,6,8H2,(H,15,20);1-4,12H |
| InChIKey | IGDUDSSQYBZJBN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione?
The IUPAC name of 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione (CID 142171356) is 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione.
What is the SMILES notation for 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione?
The canonical SMILES for 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione is O=C1c2ccccc2C(=O)N1O.O=Cc1ccccc1C(=O)NCCCn1ccnc1[N+](=O)[O-].
What is the InChIKey of 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione?
The InChIKey is IGDUDSSQYBZJBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O4.C8H5NO3/c19-10-11-4-1-2-5-12(11)13(20)15-6-3-8-17-9-7-16-14(17)18(21)22;10-7-5-3-1-2-4-6(5)8(11)9(7)12/h1-2,4-5,7,9-10H,3,6,8H2,(H,15,20);1-4,12H.
What are the key properties of 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione?
2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione has a molecular weight of 465.42 g/mol, XLogP of 2.10, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyl-N-[3-(2-nitroimidazol-1-yl)propyl]benzamide;2-hydroxyisoindole-1,3-dione is sourced from PubChem (CID 142171356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).