C13H16N6O4 — CID 176912037
N'-[2-(2-nitroimidazol-1-yl)ethyl]-N-(2-pyrrol-1-ylethyl)oxamide (PubChem CID 176912037) has the molecular formula C13H16N6O4 and a molecular weight of 320.31 g/mol. Its IUPAC name is N'-[2-(2-nitroimidazol-1-yl)ethyl]-N-(2-pyrrol-1-ylethyl)oxamide.
| Compound Name | N'-[2-(2-nitroimidazol-1-yl)ethyl]-N-(2-pyrrol-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 176912037 |
| Molecular Formula | C13H16N6O4 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N'-[2-(2-nitroimidazol-1-yl)ethyl]-N-(2-pyrrol-1-ylethyl)oxamide |
| SMILES | O=C(NCCn1cccc1)C(=O)NCCn1ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N6O4/c20-11(14-3-8-17-6-1-2-7-17)12(21)15-4-9-18-10-5-16-13(18)19(22)23/h1-2,5-7,10H,3-4,8-9H2,(H,14,20)(H,15,21) |
| InChIKey | IOSLCPSIVFADSX-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|