C13H22N6O4S2 — CID 71540223
N-[2-(2-nitroimidazol-1-yl)ethyl]-2-[[2-oxo-2-(2-sulfanylethylamino)ethyl]-(2-sulfanylethyl)amino]acetamide (PubChem CID 71540223) has the molecular formula C13H22N6O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[2-(2-nitroimidazol-1-yl)ethyl]-2-[[2-oxo-2-(2-sulfanylethylamino)ethyl]-(2-sulfanylethyl)amino]acetamide.
| Compound Name | N-[2-(2-nitroimidazol-1-yl)ethyl]-2-[[2-oxo-2-(2-sulfanylethylamino)ethyl]-(2-sulfanylethyl)amino]acetamide |
|---|---|
| PubChem CID | 71540223 |
| Molecular Formula | C13H22N6O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-[2-(2-nitroimidazol-1-yl)ethyl]-2-[[2-oxo-2-(2-sulfanylethylamino)ethyl]-(2-sulfanylethyl)amino]acetamide |
| SMILES | O=C(CN(CCS)CC(=O)NCCn1ccnc1[N+](=O)[O-])NCCS |
| InChI | InChI=1S/C13H22N6O4S2/c20-11(9-17(6-8-25)10-12(21)15-3-7-24)14-1-4-18-5-2-16-13(18)19(22)23/h2,5,24-25H,1,3-4,6-10H2,(H,14,20)(H,15,21) |
| InChIKey | JIRASUHLEUCUNF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|