C12H21N5O3S2Tc — CID 11048562
2-[2-[3-(2-nitroimidazol-1-yl)propyl-(2-sulfidoethyl)amino]ethylamino]ethanethiolate;oxo(99Tc)technetium-99(2+) (PubChem CID 11048562) has the molecular formula C12H21N5O3S2Tc and a molecular weight of 446.37 g/mol. Its IUPAC name is 2-[2-[3-(2-nitroimidazol-1-yl)propyl-(2-sulfidoethyl)amino]ethylamino]ethanethiolate;oxo(99Tc)technetium-99(2+).
| Compound Name | 2-[2-[3-(2-nitroimidazol-1-yl)propyl-(2-sulfidoethyl)amino]ethylamino]ethanethiolate;oxo(99Tc)technetium-99(2+) |
|---|---|
| PubChem CID | 11048562 |
| Molecular Formula | C12H21N5O3S2Tc |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 2-[2-[3-(2-nitroimidazol-1-yl)propyl-(2-sulfidoethyl)amino]ethylamino]ethanethiolate;oxo(99Tc)technetium-99(2+) |
| SMILES | O=[99Tc+2].O=[N+]([O-])c1nccn1CCCN(CC[S-])CCNCC[S-] |
| InChI | InChI=1S/C12H23N5O2S2.O.Tc/c18-17(19)12-14-3-8-16(12)6-1-5-15(9-11-21)7-2-13-4-10-20;;/h3,8,13,20-21H,1-2,4-7,9-11H2;;/q;;+2/p-2/i;;1+1 |
| InChIKey | PKUYUBAPKZFVKJ-FCHARDOESA-L |
| XLogP | 0.05 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|