C15H26O — CID 142173383
6-butyl-3,4,5,6-tetrahydro-2H-cyclohepta[b]furan;ethane (PubChem CID 142173383) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 6-butyl-3,4,5,6-tetrahydro-2H-cyclohepta[b]furan;ethane.
| Compound Name | 6-butyl-3,4,5,6-tetrahydro-2H-cyclohepta[b]furan;ethane |
|---|---|
| PubChem CID | 142173383 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 6-butyl-3,4,5,6-tetrahydro-2H-cyclohepta[b]furan;ethane |
| SMILES | CC.CCCCC1C=CC2=C(CCO2)CC1 |
| InChI | InChI=1S/C13H20O.C2H6/c1-2-3-4-11-5-7-12-9-10-14-13(12)8-6-11;1-2/h6,8,11H,2-5,7,9-10H2,1H3;1-2H3 |
| InChIKey | FBUQQTUFRAPAJK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |