C21H21N5O2 — CID 142173494
ethyl (5Z)-6-amino-5-(aminomethylidene)-4-(5,6-diiminocyclohexa-1,3-dien-1-yl)-2-phenyl-4H-pyridine-3-carboxylate (PubChem CID 142173494) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is ethyl (5Z)-6-amino-5-(aminomethylidene)-4-(5,6-diiminocyclohexa-1,3-dien-1-yl)-2-phenyl-4H-pyridine-3-carboxylate.
| Compound Name | ethyl (5Z)-6-amino-5-(aminomethylidene)-4-(5,6-diiminocyclohexa-1,3-dien-1-yl)-2-phenyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142173494 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | ethyl (5Z)-6-amino-5-(aminomethylidene)-4-(5,6-diiminocyclohexa-1,3-dien-1-yl)-2-phenyl-4H-pyridine-3-carboxylate |
| SMILES | [H]/N=C1/C(C2C(C(=O)OCC)=C(c3ccccc3)N=C(N)/C2=C\N)=CC=C/C1=N\[H] |
| InChI | InChI=1S/C21H21N5O2/c1-2-28-21(27)17-16(13-9-6-10-15(23)18(13)24)14(11-22)20(25)26-19(17)12-7-4-3-5-8-12/h3-11,16,23-24H,2,22H2,1H3,(H2,25,26)/b14-11-,23-15+,24-18- |
| InChIKey | XRHHTDFHBCJJOG-XCDNMECMSA-N |
| XLogP | 2.33 |
| TPSA | 138.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|