C13H23FN6 — CID 142173840
N-(2-fluoroethyl)-5-(methylaminomethyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 142173840) has the molecular formula C13H23FN6 and a molecular weight of 282.37 g/mol. Its IUPAC name is N-(2-fluoroethyl)-5-(methylaminomethyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(2-fluoroethyl)-5-(methylaminomethyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 142173840 |
| Molecular Formula | C13H23FN6 |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | N-(2-fluoroethyl)-5-(methylaminomethyl)-6-(4-methylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | CNCc1c(NCCF)ncnc1N1CCN(C)CC1 |
| InChI | InChI=1S/C13H23FN6/c1-15-9-11-12(16-4-3-14)17-10-18-13(11)20-7-5-19(2)6-8-20/h10,15H,3-9H2,1-2H3,(H,16,17,18) |
| InChIKey | AYEXNPBEFMDINO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |