C18H25N6+ — CID 142173804
[4-[(4-methylphenyl)methylamino]-6-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methylideneazanium (PubChem CID 142173804) has the molecular formula C18H25N6+ and a molecular weight of 325.44 g/mol. Its IUPAC name is [4-[(4-methylphenyl)methylamino]-6-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methylideneazanium.
| Compound Name | [4-[(4-methylphenyl)methylamino]-6-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methylideneazanium |
|---|---|
| PubChem CID | 142173804 |
| Molecular Formula | C18H25N6+ |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | [4-[(4-methylphenyl)methylamino]-6-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methylideneazanium |
| SMILES | Cc1ccc(CNc2ncnc(N3CCN(C)CC3)c2C=[NH2+])cc1 |
| InChI | InChI=1S/C18H24N6/c1-14-3-5-15(6-4-14)12-20-17-16(11-19)18(22-13-21-17)24-9-7-23(2)8-10-24/h3-6,11,13,19H,7-10,12H2,1-2H3,(H,20,21,22)/p+1 |
| InChIKey | PCXBXQDLWNKQHZ-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|