C17H21N7O2 — CID 142173812
5-methanimidoyl-6-(4-methylpiperazin-1-yl)-N-[(3-nitrophenyl)methyl]pyrimidin-4-amine (PubChem CID 142173812) has the molecular formula C17H21N7O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 5-methanimidoyl-6-(4-methylpiperazin-1-yl)-N-[(3-nitrophenyl)methyl]pyrimidin-4-amine.
| Compound Name | 5-methanimidoyl-6-(4-methylpiperazin-1-yl)-N-[(3-nitrophenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142173812 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 5-methanimidoyl-6-(4-methylpiperazin-1-yl)-N-[(3-nitrophenyl)methyl]pyrimidin-4-amine |
| SMILES | [H]/N=C/c1c(NCc2cccc([N+](=O)[O-])c2)ncnc1N1CCN(C)CC1 |
| InChI | InChI=1S/C17H21N7O2/c1-22-5-7-23(8-6-22)17-15(10-18)16(20-12-21-17)19-11-13-3-2-4-14(9-13)24(25)26/h2-4,9-10,12,18H,5-8,11H2,1H3,(H,19,20,21)/b18-10+ |
| InChIKey | BZQDVWVJTQRXPD-VCHYOVAHSA-N |
| XLogP | 1.75 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|