C20H30N6 — CID 142173858
5-methanimidoyl-6-(4-methylpiperazin-1-yl)-N-[(2E)-5-methyl-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]pyrimidin-4-amine (PubChem CID 142173858) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is 5-methanimidoyl-6-(4-methylpiperazin-1-yl)-N-[(2E)-5-methyl-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]pyrimidin-4-amine.
| Compound Name | 5-methanimidoyl-6-(4-methylpiperazin-1-yl)-N-[(2E)-5-methyl-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142173858 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 5-methanimidoyl-6-(4-methylpiperazin-1-yl)-N-[(2E)-5-methyl-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]pyrimidin-4-amine |
| SMILES | [H]/N=C/c1c(NCC(/C=C\C)=C/C=C(C)C)ncnc1N1CCN(C)CC1 |
| InChI | InChI=1S/C20H30N6/c1-5-6-17(8-7-16(2)3)14-22-19-18(13-21)20(24-15-23-19)26-11-9-25(4)10-12-26/h5-8,13,15,21H,9-12,14H2,1-4H3,(H,22,23,24)/b6-5-,17-8+,21-13+ |
| InChIKey | VADFTQIOJRSVMH-AMESTCATSA-N |
| XLogP | 3.11 |
| TPSA | 68.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|