C13H22N6 — CID 89392806
4-N-[2-(azepan-1-yl)ethyl]-5-methanimidoylpyrimidine-4,6-diamine (PubChem CID 89392806) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-N-[2-(azepan-1-yl)ethyl]-5-methanimidoylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(azepan-1-yl)ethyl]-5-methanimidoylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 89392806 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 4-N-[2-(azepan-1-yl)ethyl]-5-methanimidoylpyrimidine-4,6-diamine |
| SMILES | [H]/N=C/c1c(N)ncnc1NCCN1CCCCCC1 |
| InChI | InChI=1S/C13H22N6/c14-9-11-12(15)17-10-18-13(11)16-5-8-19-6-3-1-2-4-7-19/h9-10,14H,1-8H2,(H3,15,16,17,18)/b14-9+ |
| InChIKey | GNGFIJVCUUUNFY-NTEUORMPSA-N |
| XLogP | 1.34 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|