C26H23ClF3N3OS — CID 142179776
3-[4-[4-[[2-chloro-5-(trifluoromethyl)anilino]sulfanyloxymethyl]piperidin-4-yl]phenyl]benzonitrile (PubChem CID 142179776) has the molecular formula C26H23ClF3N3OS and a molecular weight of 518.00 g/mol. Its IUPAC name is 3-[4-[4-[[2-chloro-5-(trifluoromethyl)anilino]sulfanyloxymethyl]piperidin-4-yl]phenyl]benzonitrile.
| Compound Name | 3-[4-[4-[[2-chloro-5-(trifluoromethyl)anilino]sulfanyloxymethyl]piperidin-4-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 142179776 |
| Molecular Formula | C26H23ClF3N3OS |
| Molecular Weight | 518.00 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 3-[4-[4-[[2-chloro-5-(trifluoromethyl)anilino]sulfanyloxymethyl]piperidin-4-yl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(C3(COSNc4cc(C(F)(F)F)ccc4Cl)CCNCC3)cc2)c1 |
| InChI | InChI=1S/C26H23ClF3N3OS/c27-23-9-8-22(26(28,29)30)15-24(23)33-35-34-17-25(10-12-32-13-11-25)21-6-4-19(5-7-21)20-3-1-2-18(14-20)16-31/h1-9,14-15,32-33H,10-13,17H2 |
| InChIKey | UGMXORNMEXJQLW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.00 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|