C24H22N4O4 — CID 142180487
5-cyano-2-hydroxy-N,N-dimethyl-3-[[2-[[(1R)-2-methyl-1-phenylprop-2-enyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzamide (PubChem CID 142180487) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 5-cyano-2-hydroxy-N,N-dimethyl-3-[[2-[[(1R)-2-methyl-1-phenylprop-2-enyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzamide.
| Compound Name | 5-cyano-2-hydroxy-N,N-dimethyl-3-[[2-[[(1R)-2-methyl-1-phenylprop-2-enyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzamide |
|---|---|
| PubChem CID | 142180487 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 5-cyano-2-hydroxy-N,N-dimethyl-3-[[2-[[(1R)-2-methyl-1-phenylprop-2-enyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzamide |
| SMILES | C=C(C)[C@@H](Nc1c(Nc2cc(C#N)cc(C(=O)N(C)C)c2O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O4/c1-13(2)18(15-8-6-5-7-9-15)27-20-19(22(30)23(20)31)26-17-11-14(12-25)10-16(21(17)29)24(32)28(3)4/h5-11,18,26-27,29H,1H2,2-4H3/t18-/m1/s1 |
| InChIKey | MFGUVLYJFVWGHV-GOSISDBHSA-N |
| XLogP | 3.03 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|