C20H16ClN5O — CID 142181225
3-chloro-5-[1-[[(4-cyanophenyl)methylamino]methyl]-3-methylpyrazol-4-yl]oxybenzonitrile (PubChem CID 142181225) has the molecular formula C20H16ClN5O and a molecular weight of 377.84 g/mol. Its IUPAC name is 3-chloro-5-[1-[[(4-cyanophenyl)methylamino]methyl]-3-methylpyrazol-4-yl]oxybenzonitrile.
| Compound Name | 3-chloro-5-[1-[[(4-cyanophenyl)methylamino]methyl]-3-methylpyrazol-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 142181225 |
| Molecular Formula | C20H16ClN5O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 3-chloro-5-[1-[[(4-cyanophenyl)methylamino]methyl]-3-methylpyrazol-4-yl]oxybenzonitrile |
| SMILES | Cc1nn(CNCc2ccc(C#N)cc2)cc1Oc1cc(Cl)cc(C#N)c1 |
| InChI | InChI=1S/C20H16ClN5O/c1-14-20(27-19-7-17(10-23)6-18(21)8-19)12-26(25-14)13-24-11-16-4-2-15(9-22)3-5-16/h2-8,12,24H,11,13H2,1H3 |
| InChIKey | OAHGZZLMHWWYPK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |