About 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol
2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol (PubChem CID 142182127) has the molecular formula C18H21N3O4
and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol.
Molecular Properties
| Compound Name | 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol |
| PubChem CID | 142182127 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCC(CCNCC(O)c1cccnc1)O2 |
| InChI | InChI=1S/C18H21N3O4/c22-17(14-2-1-8-19-11-14)12-20-9-7-16-5-3-13-10-15(21(23)24)4-6-18(13)25-16/h1-2,4,6,8,10-11,16-17,20,22H,3,5,7,9,12H2 |
| InChIKey | LXKSFOQUIDLJTI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol?
The IUPAC name of 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol (CID 142182127) is 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol.
What is the SMILES notation for 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol?
The canonical SMILES for 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol is O=[N+]([O-])c1ccc2c(c1)CCC(CCNCC(O)c1cccnc1)O2.
What is the InChIKey of 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol?
The InChIKey is LXKSFOQUIDLJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O4/c22-17(14-2-1-8-19-11-14)12-20-9-7-16-5-3-13-10-15(21(23)24)4-6-18(13)25-16/h1-2,4,6,8,10-11,16-17,20,22H,3,5,7,9,12H2.
What are the key properties of 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol?
2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol has a molecular weight of 343.38 g/mol, XLogP of 2.40, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol is sourced from PubChem (CID 142182127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).