C18H21N3O4 — CID 142182127
2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol (PubChem CID 142182127) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol.
| Compound Name | 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 142182127 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[2-(6-nitro-3,4-dihydro-2H-chromen-2-yl)ethylamino]-1-pyridin-3-ylethanol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCC(CCNCC(O)c1cccnc1)O2 |
| InChI | InChI=1S/C18H21N3O4/c22-17(14-2-1-8-19-11-14)12-20-9-7-16-5-3-13-10-15(21(23)24)4-6-18(13)25-16/h1-2,4,6,8,10-11,16-17,20,22H,3,5,7,9,12H2 |
| InChIKey | LXKSFOQUIDLJTI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|