C17H20N2O5S — CID 87711514
(2R)-2-[[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]methyl]-3,4-dihydro-2H-chromene-6-sulfonic acid (PubChem CID 87711514) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is (2R)-2-[[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]methyl]-3,4-dihydro-2H-chromene-6-sulfonic acid.
| Compound Name | (2R)-2-[[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]methyl]-3,4-dihydro-2H-chromene-6-sulfonic acid |
|---|---|
| PubChem CID | 87711514 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2R)-2-[[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]methyl]-3,4-dihydro-2H-chromene-6-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)CC[C@H](CNC[C@@H](O)c1cccnc1)O2 |
| InChI | InChI=1S/C17H20N2O5S/c20-16(13-2-1-7-18-9-13)11-19-10-14-4-3-12-8-15(25(21,22)23)5-6-17(12)24-14/h1-2,5-9,14,16,19-20H,3-4,10-11H2,(H,21,22,23)/t14-,16-/m1/s1 |
| InChIKey | JEHBBQMNNDUNAT-GDBMZVCRSA-N |
| XLogP | 1.35 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|