C30H27N5O6S — CID 20815739
N-(2-cyano-4-nitrophenyl)-3-[2-[[(2-hydroxy-2-pyridin-3-ylethyl)amino]methyl]-3,4-dihydro-2H-chromen-6-yl]benzenesulfonamide (PubChem CID 20815739) has the molecular formula C30H27N5O6S and a molecular weight of 585.64 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-3-[2-[[(2-hydroxy-2-pyridin-3-ylethyl)amino]methyl]-3,4-dihydro-2H-chromen-6-yl]benzenesulfonamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-3-[2-[[(2-hydroxy-2-pyridin-3-ylethyl)amino]methyl]-3,4-dihydro-2H-chromen-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 20815739 |
| Molecular Formula | C30H27N5O6S |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-3-[2-[[(2-hydroxy-2-pyridin-3-ylethyl)amino]methyl]-3,4-dihydro-2H-chromen-6-yl]benzenesulfonamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NS(=O)(=O)c1cccc(-c2ccc3c(c2)CCC(CNCC(O)c2cccnc2)O3)c1 |
| InChI | InChI=1S/C30H27N5O6S/c31-16-24-14-25(35(37)38)8-10-28(24)34-42(39,40)27-5-1-3-20(15-27)21-7-11-30-22(13-21)6-9-26(41-30)18-33-19-29(36)23-4-2-12-32-17-23/h1-5,7-8,10-15,17,26,29,33-34,36H,6,9,18-19H2 |
| InChIKey | NMSDQSSYZVIHMX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 167.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|