C28H29N3O5 — CID 142183175
1,3-benzodioxole;(3S)-N-[(3,4-dimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 142183175) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is 1,3-benzodioxole;(3S)-N-[(3,4-dimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1,3-benzodioxole;(3S)-N-[(3,4-dimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 142183175 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 1,3-benzodioxole;(3S)-N-[(3,4-dimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@@H]2Cc3c([nH]c4ccccc34)CN2)cc1OC.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23N3O3.C7H6O2/c1-26-19-8-7-13(9-20(19)27-2)11-23-21(25)17-10-15-14-5-3-4-6-16(14)24-18(15)12-22-17;1-2-4-7-6(3-1)8-5-9-7/h3-9,17,22,24H,10-12H2,1-2H3,(H,23,25);1-4H,5H2/t17-;/m0./s1 |
| InChIKey | RZCXBRQTLOHQBJ-LMOVPXPDSA-N |
| XLogP | 3.93 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|