C19H18BrFN2O3 — CID 145074632
4-bromo-2-fluoro-1-methoxybenzene;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 145074632) has the molecular formula C19H18BrFN2O3 and a molecular weight of 421.27 g/mol. Its IUPAC name is 4-bromo-2-fluoro-1-methoxybenzene;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 4-bromo-2-fluoro-1-methoxybenzene;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 145074632 |
| Molecular Formula | C19H18BrFN2O3 |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 4-bromo-2-fluoro-1-methoxybenzene;2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | COc1ccc(Br)cc1F.O=C(O)C1Cc2c([nH]c3ccccc23)CN1 |
| InChI | InChI=1S/C12H12N2O2.C7H6BrFO/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10;1-10-7-3-2-5(8)4-6(7)9/h1-4,10,13-14H,5-6H2,(H,15,16);2-4H,1H3 |
| InChIKey | YAXYCHIYRMFEON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|