C20H21F2N3O — CID 145074670
1,3-difluoro-5-methylbenzene;N-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 145074670) has the molecular formula C20H21F2N3O and a molecular weight of 357.40 g/mol. Its IUPAC name is 1,3-difluoro-5-methylbenzene;N-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1,3-difluoro-5-methylbenzene;N-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 145074670 |
| Molecular Formula | C20H21F2N3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1,3-difluoro-5-methylbenzene;N-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CNC(=O)C1Cc2c([nH]c3ccccc23)CN1.Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H15N3O.C7H6F2/c1-14-13(17)11-6-9-8-4-2-3-5-10(8)16-12(9)7-15-11;1-5-2-6(8)4-7(9)3-5/h2-5,11,15-16H,6-7H2,1H3,(H,14,17);2-4H,1H3 |
| InChIKey | ZSQCRDCLDYSIGU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|