C17H14ClF3N2OS — CID 142185021
N-(1-amino-2,2,2-trifluoroethylidene)-4-[(4-chlorophenyl)methoxy]-3-methylbenzenecarbothioamide (PubChem CID 142185021) has the molecular formula C17H14ClF3N2OS and a molecular weight of 386.83 g/mol. Its IUPAC name is N-(1-amino-2,2,2-trifluoroethylidene)-4-[(4-chlorophenyl)methoxy]-3-methylbenzenecarbothioamide.
| Compound Name | N-(1-amino-2,2,2-trifluoroethylidene)-4-[(4-chlorophenyl)methoxy]-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 142185021 |
| Molecular Formula | C17H14ClF3N2OS |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | N-(1-amino-2,2,2-trifluoroethylidene)-4-[(4-chlorophenyl)methoxy]-3-methylbenzenecarbothioamide |
| SMILES | Cc1cc(C(=S)/N=C(\N)C(F)(F)F)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClF3N2OS/c1-10-8-12(15(25)23-16(22)17(19,20)21)4-7-14(10)24-9-11-2-5-13(18)6-3-11/h2-8H,9H2,1H3,(H2,22,23,25) |
| InChIKey | ZUCDJYNJFNBMME-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|