C15H26N2O — CID 142186715
1-(4-aminophenyl)ethanone;N,N-diethylpropan-1-amine (PubChem CID 142186715) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-(4-aminophenyl)ethanone;N,N-diethylpropan-1-amine.
| Compound Name | 1-(4-aminophenyl)ethanone;N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 142186715 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 1-(4-aminophenyl)ethanone;N,N-diethylpropan-1-amine |
| SMILES | CC(=O)c1ccc(N)cc1.CCCN(CC)CC |
| InChI | InChI=1S/C8H9NO.C7H17N/c1-6(10)7-2-4-8(9)5-3-7;1-4-7-8(5-2)6-3/h2-5H,9H2,1H3;4-7H2,1-3H3 |
| InChIKey | YFTRSCGZKFLXRP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|