C10H17FN2 — CID 142187247
1-[(1E)-4-fluoropenta-1,4-dienyl]-4-methylpiperazine (PubChem CID 142187247) has the molecular formula C10H17FN2 and a molecular weight of 184.26 g/mol. Its IUPAC name is 1-[(1E)-4-fluoropenta-1,4-dienyl]-4-methylpiperazine.
| Compound Name | 1-[(1E)-4-fluoropenta-1,4-dienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142187247 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 1-[(1E)-4-fluoropenta-1,4-dienyl]-4-methylpiperazine |
| SMILES | C=C(F)C/C=C/N1CCN(C)CC1 |
| InChI | InChI=1S/C10H17FN2/c1-10(11)4-3-5-13-8-6-12(2)7-9-13/h3,5H,1,4,6-9H2,2H3/b5-3+ |
| InChIKey | ZPVSFWVLJASUDD-HWKANZROSA-N |
| XLogP | 1.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |