C9H16N2 — CID 15665727
1-[(1E)-buta-1,3-dienyl]-4-methylpiperazine (PubChem CID 15665727) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-[(1E)-buta-1,3-dienyl]-4-methylpiperazine.
| Compound Name | 1-[(1E)-buta-1,3-dienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 15665727 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-[(1E)-buta-1,3-dienyl]-4-methylpiperazine |
| SMILES | C=C/C=C/N1CCN(C)CC1 |
| InChI | InChI=1S/C9H16N2/c1-3-4-5-11-8-6-10(2)7-9-11/h3-5H,1,6-9H2,2H3/b5-4+ |
| InChIKey | RPMMEVJYKFQANS-SNAWJCMRSA-N |
| XLogP | 0.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|