C18H18O2 — CID 142187410
7-(1-phenylbutoxy)-1-benzofuran (PubChem CID 142187410) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 7-(1-phenylbutoxy)-1-benzofuran.
| Compound Name | 7-(1-phenylbutoxy)-1-benzofuran |
|---|---|
| PubChem CID | 142187410 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 7-(1-phenylbutoxy)-1-benzofuran |
| SMILES | CCCC(Oc1cccc2ccoc12)c1ccccc1 |
| InChI | InChI=1S/C18H18O2/c1-2-7-16(14-8-4-3-5-9-14)20-17-11-6-10-15-12-13-19-18(15)17/h3-6,8-13,16H,2,7H2,1H3 |
| InChIKey | UQIWETIZSKSLKV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |