C16H17NO2S — CID 146380552
(3R)-3-(1-benzofuran-7-yloxy)-N-methyl-3-thiophen-3-ylpropan-1-amine (PubChem CID 146380552) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is (3R)-3-(1-benzofuran-7-yloxy)-N-methyl-3-thiophen-3-ylpropan-1-amine.
| Compound Name | (3R)-3-(1-benzofuran-7-yloxy)-N-methyl-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 146380552 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (3R)-3-(1-benzofuran-7-yloxy)-N-methyl-3-thiophen-3-ylpropan-1-amine |
| SMILES | CNCC[C@@H](Oc1cccc2ccoc12)c1ccsc1 |
| InChI | InChI=1S/C16H17NO2S/c1-17-8-5-14(13-7-10-20-11-13)19-15-4-2-3-12-6-9-18-16(12)15/h2-4,6-7,9-11,14,17H,5,8H2,1H3/t14-/m1/s1 |
| InChIKey | KQJWBRDZJMJBBP-CQSZACIVSA-N |
| XLogP | 4.22 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |