C19H20N4O4S2 — CID 142188075
N-[2-oxo-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]-1H-quinolin-3-yl]methanesulfonamide (PubChem CID 142188075) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N-[2-oxo-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]-1H-quinolin-3-yl]methanesulfonamide.
| Compound Name | N-[2-oxo-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]-1H-quinolin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 142188075 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[2-oxo-4-[4-(thiophene-2-carbonyl)piperazin-1-yl]-1H-quinolin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1c(N2CCN(C(=O)c3cccs3)CC2)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C19H20N4O4S2/c1-29(26,27)21-16-17(13-5-2-3-6-14(13)20-18(16)24)22-8-10-23(11-9-22)19(25)15-7-4-12-28-15/h2-7,12,21H,8-11H2,1H3,(H,20,24) |
| InChIKey | MHADCGBIGCZNCH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |