C20H18N2O5 — CID 142188256
1-(6,7-dihydro-[1,3]dioxolo[4,5-g][1,4]benzodioxin-6-yl)-N-(quinolin-7-yloxymethyl)methanamine (PubChem CID 142188256) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-(6,7-dihydro-[1,3]dioxolo[4,5-g][1,4]benzodioxin-6-yl)-N-(quinolin-7-yloxymethyl)methanamine.
| Compound Name | 1-(6,7-dihydro-[1,3]dioxolo[4,5-g][1,4]benzodioxin-6-yl)-N-(quinolin-7-yloxymethyl)methanamine |
|---|---|
| PubChem CID | 142188256 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-(6,7-dihydro-[1,3]dioxolo[4,5-g][1,4]benzodioxin-6-yl)-N-(quinolin-7-yloxymethyl)methanamine |
| SMILES | c1cnc2cc(OCNCC3COc4cc5c(cc4O3)OCO5)ccc2c1 |
| InChI | InChI=1S/C20H18N2O5/c1-2-13-3-4-14(6-16(13)22-5-1)24-11-21-9-15-10-23-19-7-17-18(26-12-25-17)8-20(19)27-15/h1-8,15,21H,9-12H2 |
| InChIKey | KOYLQGVEUXPCGY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|