C10H19NS — CID 142188533
(3E,5Z)-9-(methylamino)nona-3,5-diene-4-thiol (PubChem CID 142188533) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is (3E,5Z)-9-(methylamino)nona-3,5-diene-4-thiol.
| Compound Name | (3E,5Z)-9-(methylamino)nona-3,5-diene-4-thiol |
|---|---|
| PubChem CID | 142188533 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (3E,5Z)-9-(methylamino)nona-3,5-diene-4-thiol |
| SMILES | CC/C=C(S)\C=C/CCCNC |
| InChI | InChI=1S/C10H19NS/c1-3-7-10(12)8-5-4-6-9-11-2/h5,7-8,11-12H,3-4,6,9H2,1-2H3/b8-5-,10-7+ |
| InChIKey | VVKKGNSCRAHYSJ-OEPUHGBTSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|