C9H17NO2 — CID 143279731
(3Z,5Z)-8-(methylamino)octa-3,5-diene-3,4-diol (PubChem CID 143279731) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (3Z,5Z)-8-(methylamino)octa-3,5-diene-3,4-diol.
| Compound Name | (3Z,5Z)-8-(methylamino)octa-3,5-diene-3,4-diol |
|---|---|
| PubChem CID | 143279731 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (3Z,5Z)-8-(methylamino)octa-3,5-diene-3,4-diol |
| SMILES | CC/C(O)=C(O)\C=C/CCNC |
| InChI | InChI=1S/C9H17NO2/c1-3-8(11)9(12)6-4-5-7-10-2/h4,6,10-12H,3,5,7H2,1-2H3/b6-4-,9-8- |
| InChIKey | NKINNBGHPOYPPW-KDAARUEYSA-N |
| XLogP | 1.89 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|