C20H28N2OS — CID 142191077
N-[(E)-2,2-dimethylpropylideneamino]-2-methoxy-5-phenylaniline;methylsulfanylmethane (PubChem CID 142191077) has the molecular formula C20H28N2OS and a molecular weight of 344.52 g/mol. Its IUPAC name is N-[(E)-2,2-dimethylpropylideneamino]-2-methoxy-5-phenylaniline;methylsulfanylmethane.
| Compound Name | N-[(E)-2,2-dimethylpropylideneamino]-2-methoxy-5-phenylaniline;methylsulfanylmethane |
|---|---|
| PubChem CID | 142191077 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[(E)-2,2-dimethylpropylideneamino]-2-methoxy-5-phenylaniline;methylsulfanylmethane |
| SMILES | COc1ccc(-c2ccccc2)cc1N/N=C/C(C)(C)C.CSC |
| InChI | InChI=1S/C18H22N2O.C2H6S/c1-18(2,3)13-19-20-16-12-15(10-11-17(16)21-4)14-8-6-5-7-9-14;1-3-2/h5-13,20H,1-4H3;1-2H3/b19-13+; |
| InChIKey | SLDUNRIZYDJZNW-XTWSRORZSA-N |
| XLogP | 5.79 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|