C18H31N3O3 — CID 142191385
[1-(cyanomethylamino)-1-oxopropan-2-yl] piperidine-1-carboxylate;methylcyclohexane (PubChem CID 142191385) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is [1-(cyanomethylamino)-1-oxopropan-2-yl] piperidine-1-carboxylate;methylcyclohexane.
| Compound Name | [1-(cyanomethylamino)-1-oxopropan-2-yl] piperidine-1-carboxylate;methylcyclohexane |
|---|---|
| PubChem CID | 142191385 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | [1-(cyanomethylamino)-1-oxopropan-2-yl] piperidine-1-carboxylate;methylcyclohexane |
| SMILES | CC(OC(=O)N1CCCCC1)C(=O)NCC#N.CC1CCCCC1 |
| InChI | InChI=1S/C11H17N3O3.C7H14/c1-9(10(15)13-6-5-12)17-11(16)14-7-3-2-4-8-14;1-7-5-3-2-4-6-7/h9H,2-4,6-8H2,1H3,(H,13,15);7H,2-6H2,1H3 |
| InChIKey | UTWNRELMRWJGKI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|