C15H33N3O3S — CID 142191738
(2S)-2-amino-3-butylsulfonyl-N-[3-(3-methylbutylamino)propyl]propanamide (PubChem CID 142191738) has the molecular formula C15H33N3O3S and a molecular weight of 335.51 g/mol. Its IUPAC name is (2S)-2-amino-3-butylsulfonyl-N-[3-(3-methylbutylamino)propyl]propanamide.
| Compound Name | (2S)-2-amino-3-butylsulfonyl-N-[3-(3-methylbutylamino)propyl]propanamide |
|---|---|
| PubChem CID | 142191738 |
| Molecular Formula | C15H33N3O3S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (2S)-2-amino-3-butylsulfonyl-N-[3-(3-methylbutylamino)propyl]propanamide |
| SMILES | CCCCS(=O)(=O)C[C@@H](N)C(=O)NCCCNCCC(C)C |
| InChI | InChI=1S/C15H33N3O3S/c1-4-5-11-22(20,21)12-14(16)15(19)18-9-6-8-17-10-7-13(2)3/h13-14,17H,4-12,16H2,1-3H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | SVODLMVPAWDTPB-CQSZACIVSA-N |
| XLogP | 0.67 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|