C32H42N2O6S — CID 142191805
4-(benzenesulfonyl)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-2-(propoxymethyl)butanamide (PubChem CID 142191805) has the molecular formula C32H42N2O6S and a molecular weight of 582.76 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-2-(propoxymethyl)butanamide.
| Compound Name | 4-(benzenesulfonyl)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-2-(propoxymethyl)butanamide |
|---|---|
| PubChem CID | 142191805 |
| Molecular Formula | C32H42N2O6S |
| Molecular Weight | 582.76 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-2-(propoxymethyl)butanamide |
| SMILES | CCCOCC(CCS(=O)(=O)c1ccccc1)C(=O)N[C@@H](Cc1ccccc1)[C@H](O)CNCc1cccc(OC)c1 |
| InChI | InChI=1S/C32H42N2O6S/c1-3-18-40-24-27(17-19-41(37,38)29-15-8-5-9-16-29)32(36)34-30(21-25-11-6-4-7-12-25)31(35)23-33-22-26-13-10-14-28(20-26)39-2/h4-16,20,27,30-31,33,35H,3,17-19,21-24H2,1-2H3,(H,34,36)/t27?,30-,31+/m0/s1 |
| InChIKey | VLONOLRHLUZGPT-MFWJYYTKSA-N |
| XLogP | 3.78 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|