C30H44N2O6S — CID 59095992
2-(acetylsulfonylmethyl)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-7-methyloctanamide (PubChem CID 59095992) has the molecular formula C30H44N2O6S and a molecular weight of 560.76 g/mol. Its IUPAC name is 2-(acetylsulfonylmethyl)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-7-methyloctanamide.
| Compound Name | 2-(acetylsulfonylmethyl)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-7-methyloctanamide |
|---|---|
| PubChem CID | 59095992 |
| Molecular Formula | C30H44N2O6S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 2-(acetylsulfonylmethyl)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-7-methyloctanamide |
| SMILES | COc1cccc(CNC[C@@H](O)[C@H](Cc2ccccc2)NC(=O)C(CCCCC(C)C)CS(=O)(=O)C(C)=O)c1 |
| InChI | InChI=1S/C30H44N2O6S/c1-22(2)11-8-9-15-26(21-39(36,37)23(3)33)30(35)32-28(18-24-12-6-5-7-13-24)29(34)20-31-19-25-14-10-16-27(17-25)38-4/h5-7,10,12-14,16-17,22,26,28-29,31,34H,8-9,11,15,18-21H2,1-4H3,(H,32,35)/t26?,28-,29+/m0/s1 |
| InChIKey | PVZDRCVNZHMUFS-GXRAEGJDSA-N |
| XLogP | 3.67 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|