C16H16ClNO3 — CID 142191897
ethyl 1-(2-chloroquinolin-4-yl)oxycyclobutane-1-carboxylate (PubChem CID 142191897) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is ethyl 1-(2-chloroquinolin-4-yl)oxycyclobutane-1-carboxylate.
| Compound Name | ethyl 1-(2-chloroquinolin-4-yl)oxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 142191897 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | ethyl 1-(2-chloroquinolin-4-yl)oxycyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(Oc2cc(Cl)nc3ccccc23)CCC1 |
| InChI | InChI=1S/C16H16ClNO3/c1-2-20-15(19)16(8-5-9-16)21-13-10-14(17)18-12-7-4-3-6-11(12)13/h3-4,6-7,10H,2,5,8-9H2,1H3 |
| InChIKey | DXWPQKGOPPCPQP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|