C27H23NO3 — CID 134867055
ethyl 1-(2-naphthalen-1-ylquinolin-4-yl)-2-oxocyclopentane-1-carboxylate (PubChem CID 134867055) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is ethyl 1-(2-naphthalen-1-ylquinolin-4-yl)-2-oxocyclopentane-1-carboxylate.
| Compound Name | ethyl 1-(2-naphthalen-1-ylquinolin-4-yl)-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134867055 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | ethyl 1-(2-naphthalen-1-ylquinolin-4-yl)-2-oxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2cc(-c3cccc4ccccc34)nc3ccccc23)CCCC1=O |
| InChI | InChI=1S/C27H23NO3/c1-2-31-26(30)27(16-8-15-25(27)29)22-17-24(28-23-14-6-5-12-21(22)23)20-13-7-10-18-9-3-4-11-19(18)20/h3-7,9-14,17H,2,8,15-16H2,1H3 |
| InChIKey | VHJZAVZYQFKZEC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|