C12H20N2O5 — CID 142196003
tert-butyl 2-hydroperoxy-4-prop-2-enoxyiminopyrrolidine-1-carboxylate (PubChem CID 142196003) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is tert-butyl 2-hydroperoxy-4-prop-2-enoxyiminopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-hydroperoxy-4-prop-2-enoxyiminopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142196003 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | tert-butyl 2-hydroperoxy-4-prop-2-enoxyiminopyrrolidine-1-carboxylate |
| SMILES | C=CCON=C1CC(OO)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H20N2O5/c1-5-6-17-13-9-7-10(19-16)14(8-9)11(15)18-12(2,3)4/h5,10,16H,1,6-8H2,2-4H3 |
| InChIKey | TXSMBLDGLJVXEA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|