C13H24N2O4 — CID 178181198
tert-butyl (2S)-2-(1-hydroxypropyl)-4-methoxyiminopyrrolidine-1-carboxylate (PubChem CID 178181198) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1-hydroxypropyl)-4-methoxyiminopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(1-hydroxypropyl)-4-methoxyiminopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178181198 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | tert-butyl (2S)-2-(1-hydroxypropyl)-4-methoxyiminopyrrolidine-1-carboxylate |
| SMILES | CCC(O)[C@@H]1CC(=NOC)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O4/c1-6-11(16)10-7-9(14-18-5)8-15(10)12(17)19-13(2,3)4/h10-11,16H,6-8H2,1-5H3/t10-,11?/m0/s1 |
| InChIKey | YNNRUDQYOBQRCT-VUWPPUDQSA-N |
| XLogP | 1.77 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|