C17H32 — CID 142196202
3,3-dimethylpentane;ethane;1,4-xylene (PubChem CID 142196202) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is 3,3-dimethylpentane;ethane;1,4-xylene.
| Compound Name | 3,3-dimethylpentane;ethane;1,4-xylene |
|---|---|
| PubChem CID | 142196202 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 3,3-dimethylpentane;ethane;1,4-xylene |
| SMILES | CC.CCC(C)(C)CC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C7H16.C2H6/c1-7-3-5-8(2)6-4-7;1-5-7(3,4)6-2;1-2/h3-6H,1-2H3;5-6H2,1-4H3;1-2H3 |
| InChIKey | LKRXMBRHJZSGJX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |